CAS 1350540-04-3

3-(Dimethylamino)-4-nitrobenzoic acid

Description:

3-(Dimethylamino)-4-nitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a dimethylamino group and a nitro group. The presence of the dimethylamino group contributes to its basicity and potential for forming salts, while the nitro group introduces electron-withdrawing properties, influencing the compound's reactivity and polarity. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functional group. It may exhibit various chemical behaviors, including participation in electrophilic aromatic substitution reactions and potential interactions with biological systems, making it of interest in pharmaceutical and chemical research. Additionally, its properties can be affected by pH and solvent conditions, which can alter its ionization state and solubility. Safety data should be consulted for handling and storage, as compounds with nitro and amino groups can pose specific hazards.

Formula: C₉H₁₀N₂O₄

InChI: InChI=1S/C9H10N2O4/c1-10(2)8-5-6(9(12)13)3-4-7(8)11(14)15/h3-5H,1-2H3,(H,12,13)

InChI key: InChIKey=HMRMOFDVYIXAMW-UHFFFAOYSA-N

SMILES: N(C)(C)C1=C(N(=O)=O)C=CC(C(O)=O)=C1

Synonyms:

• Benzoic acid, 3-(dimethylamino)-4-nitro-
• 3-(Dimethylamino)-4-nitrobenzoic acid