CAS 1350760-10-9

3-Pyridinecarboxylic acid, 6-(1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-, hydrochloride (1:2)

Description:

3-Pyridinecarboxylic acid, 6-(1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyridine ring and a spirocyclic moiety. The presence of the pyridinecarboxylic acid functional group suggests it may exhibit acidic properties, while the spirocyclic structure contributes to its unique three-dimensional conformation, potentially influencing its biological activity and interactions. The hydrochloride form indicates that the compound is a salt, which can enhance its solubility in aqueous solutions, making it more suitable for various applications, including pharmaceutical formulations. The compound may possess potential pharmacological properties, given its structural features, which could be explored in medicinal chemistry. Additionally, the presence of nitrogen and oxygen atoms in its structure may contribute to hydrogen bonding capabilities, affecting its reactivity and interactions with other molecules. Overall, this compound's characteristics make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₃H₁₅N₃O₃·2ClH

InChI: InChI=1S/C13H15N3O3.2ClH/c17-12(18)9-1-2-10(15-8-9)11-7-13(19-16-11)3-5-14-6-4-13;;/h1-2,8,14H,3-7H2,(H,17,18);2*1H

InChI key: InChIKey=CEDGWTZKDPDHJC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=C(C=2CC3(ON2)CCNCC3)N=C1.Cl

Synonyms:

• 3-Pyridinecarboxylic acid, 6-(1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-, hydrochloride (1:2)