CAS 1350760-31-4

4-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole-3-carboxaldehyde

Description:

4-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a carboxaldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation. The compound features a fluorophenyl substituent, which can influence its electronic properties and reactivity due to the electronegative fluorine atom. Additionally, the isopropyl group (1-methylethyl) contributes to the steric bulk and hydrophobic character of the molecule. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug design. Its unique structural features could also lead to specific interactions with biological targets, potentially influencing its pharmacological profile. Overall, the combination of functional groups and substituents in this compound suggests a versatile chemical behavior suitable for various applications in research and industry.

Formula: C₁₈H₁₆FNO

InChI: InChI=1S/C18H16FNO/c1-12(2)20-10-14(11-21)18-16(4-3-5-17(18)20)13-6-8-15(19)9-7-13/h3-12H,1-2H3

InChI key: InChIKey=WOHGKDZHTGLKNV-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(N(C(C)C)C1)=CC=CC2C3=CC=C(F)C=C3

Synonyms:

• 4-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole-3-carboxaldehyde
• 4-(4-Fluorophenyl)-1-(propan-2-yl)-1H-indole-3-carboxaldehyde
• 1H-Indole-3-carboxaldehyde, 4-(4-fluorophenyl)-1-(1-methylethyl)-