CAS 1350760-46-1
:4-Bromo-1-(1-methylethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
Description:
4-Bromo-1-(1-methylethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolopyridine framework. This compound features a bromine substituent at the 4-position and an isopropyl group at the 1-position, contributing to its unique chemical properties. The presence of the aldehyde functional group at the 3-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. The compound is likely to exhibit moderate solubility in organic solvents due to its polar aldehyde group and non-polar hydrocarbon portions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as heterocycles are often found in biologically active compounds. Additionally, the bromine atom may provide opportunities for further functionalization, making it a versatile intermediate in synthetic organic chemistry. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.
Formula:C11H11BrN2O
InChI:InChI=1S/C11H11BrN2O/c1-7(2)14-5-8(6-15)10-9(12)3-4-13-11(10)14/h3-7H,1-2H3
InChI key:InChIKey=SPPMNKQXQIEREU-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=2C(C(C=O)=C1)=C(Br)C=CN2
Synonyms:- 4-Bromo-1-(1-methylethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
- 1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 4-bromo-1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.