CAS 1350760-48-3

4-(4-Fluorophenyl)-1-(1-methylethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde

Description:

4-(4-Fluorophenyl)-1-(1-methylethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core, a fluorophenyl group, and an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the aldehyde group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The presence of the isopropyl group contributes to steric hindrance, which may affect its interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could lead to specific biological activities. As with many organic compounds, its solubility, melting point, and reactivity would depend on the specific conditions and solvents used in experiments or applications.

Formula: C₁₇H₁₅FN₂O

InChI: InChI=1S/C17H15FN2O/c1-11(2)20-9-13(10-21)16-15(7-8-19-17(16)20)12-3-5-14(18)6-4-12/h3-11H,1-2H3

InChI key: InChIKey=XEQOLXRLIGIVGO-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(N(C(C)C)C1)=NC=CC2C3=CC=C(F)C=C3

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 4-(4-fluorophenyl)-1-(1-methylethyl)-
• 4-(4-Fluorophenyl)-1-(1-methylethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde