CymitQuimica logo

CAS 1350760-50-7

:

7-Methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde

Description:
7-Methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde, with the CAS number 1350760-50-7, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure comprising a benzene ring fused to a pyrrole ring. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of a methyl group and an isopropyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The indole structure is known for its role in various natural products and pharmaceuticals, often contributing to their biological properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, 7-Methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde represents a versatile scaffold for further chemical modifications and potential therapeutic applications.
Formula:C13H15NO
InChI:InChI=1S/C13H15NO/c1-9(2)14-7-11(8-15)12-6-4-5-10(3)13(12)14/h4-9H,1-3H3
InChI key:InChIKey=SVHPZEXOPVZDIH-UHFFFAOYSA-N
SMILES:C(C)(C)N1C=2C(C(C=O)=C1)=CC=CC2C
Synonyms:
  • 7-Methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde
  • 1-Isopropyl-7-methyl-1H-indole-3-carbaldehyde
  • 1H-Indole-3-carboxaldehyde, 7-methyl-1-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.