
CAS 1350760-61-0
:1,7-Dicyclopropyl-1H-indole-3-carboxaldehyde
Description:
1,7-Dicyclopropyl-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features two cyclopropyl groups attached to the 1 and 7 positions of the indole moiety, contributing to its unique steric and electronic properties. The presence of a carboxaldehyde functional group at the 3-position introduces reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. The cyclopropyl groups can influence the compound's conformational flexibility and stability, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could lead to the development of novel pharmaceuticals or functional materials. As with many indole derivatives, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c17-9-11-8-16(12-6-7-12)15-13(10-4-5-10)2-1-3-14(11)15/h1-3,8-10,12H,4-7H2
InChI key:InChIKey=NTMOEMGSUSIQJN-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(N(C1)C3CC3)=C(C=CC2)C4CC4
Synonyms:- 1,7-Dicyclopropyl-1H-indole-3-carboxaldehyde
- 1,7-Dicyclopropyl-1H-indole-3-carbaldehyde
- 1H-Indole-3-carboxaldehyde, 1,7-dicyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.