CymitQuimica logo

CAS 1350760-63-2

:

1,6-Dicyclopropyl-1H-indole-3-carboxaldehyde

Description:
1,6-Dicyclopropyl-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of two cyclopropyl groups at the 1 and 6 positions of the indole ring contributes to its unique steric and electronic properties. The aldehyde functional group at the 3 position introduces reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, its relatively complex structure may pose challenges in synthesis and purification. As with many organic compounds, its physical properties, such as solubility, melting point, and boiling point, would depend on the specific conditions and the presence of other functional groups. Overall, 1,6-Dicyclopropyl-1H-indole-3-carboxaldehyde represents a class of compounds that could be explored for applications in medicinal chemistry and materials science.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c17-9-12-8-16(13-4-5-13)15-7-11(10-1-2-10)3-6-14(12)15/h3,6-10,13H,1-2,4-5H2
InChI key:InChIKey=PKCQOWHNWKIUJI-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(N(C1)C3CC3)=CC(=CC2)C4CC4
Synonyms:
  • 1,6-Dicyclopropyl-1H-indole-3-carboxaldehyde
  • 1,6-Dicyclopropyl-1H-indole-3-carbaldehyde
  • 1H-Indole-3-carboxaldehyde, 1,6-dicyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.