CAS 1350760-90-5

5-Cyclopropyl-7-methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde

Description:

5-Cyclopropyl-7-methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a cyclopropyl group and an isopropyl group, contributing to its unique steric and electronic properties. The presence of a carboxaldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indole moiety's prevalence in biologically active compounds. Additionally, the presence of multiple substituents may influence its solubility, reactivity, and interaction with biological targets. As with many organic compounds, its stability and reactivity can be affected by environmental factors such as temperature and pH. Overall, 5-Cyclopropyl-7-methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde represents a complex structure with potential implications in various chemical and biological fields.

Formula: C₁₆H₁₉NO

InChI: InChI=1S/C16H19NO/c1-10(2)17-8-14(9-18)15-7-13(12-4-5-12)6-11(3)16(15)17/h6-10,12H,4-5H2,1-3H3

InChI key: InChIKey=MPNJYFKLYGABLX-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(N(C(C)C)C1)=C(C)C=C(C2)C3CC3

Synonyms:

• 5-Cyclopropyl-7-methyl-1-(1-methylethyl)-1H-indole-3-carboxaldehyde
• 1H-Indole-3-carboxaldehyde, 5-cyclopropyl-7-methyl-1-(1-methylethyl)-