CymitQuimica logo

CAS 1350760-98-3

:

7-Chloro-1-cyclopropyl-1H-indole-3-carboxaldehyde

Description:
7-Chloro-1-cyclopropyl-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chloro group at the 7-position and a cyclopropyl group at the 1-position contributes to its unique reactivity and potential biological activity. The aldehyde functional group at the 3-position is significant for its reactivity, allowing for various chemical transformations, including condensation reactions and nucleophilic additions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the indole ring, making it a valuable candidate for further research in organic synthesis and pharmaceutical applications. As with many indole derivatives, it may also possess fluorescence properties, which can be useful in various analytical techniques.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c13-11-3-1-2-10-8(7-15)6-14(12(10)11)9-4-5-9/h1-3,6-7,9H,4-5H2
InChI key:InChIKey=RXYIWFQXCDEAAS-UHFFFAOYSA-N
SMILES:ClC1=C2N(C=C(C=O)C2=CC=C1)C3CC3
Synonyms:
  • 7-Chloro-1-cyclopropyl-1H-indole-3-carboxaldehyde
  • 1H-Indole-3-carboxaldehyde, 7-chloro-1-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.