CAS 1350761-29-3
:8-Cyclopropyl-3,4-dihydro-4,4-dimethyl-2H-1-benzopyran-6-carboxaldehyde
Description:
8-Cyclopropyl-3,4-dihydro-4,4-dimethyl-2H-1-benzopyran-6-carboxaldehyde, identified by its CAS number 1350761-29-3, is a synthetic organic compound characterized by its complex bicyclic structure, which includes a benzopyran moiety. This compound features a cyclopropyl group and two methyl groups at specific positions, contributing to its unique chemical properties. The presence of a carboxaldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The dihydrobenzopyran structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the compound's stereochemistry and substituent arrangement may influence its reactivity and biological activity. Overall, 8-Cyclopropyl-3,4-dihydro-4,4-dimethyl-2H-1-benzopyran-6-carboxaldehyde represents a valuable compound for further research in organic synthesis and drug development.
Formula:C15H18O2
InChI:InChI=1S/C15H18O2/c1-15(2)5-6-17-14-12(11-3-4-11)7-10(9-16)8-13(14)15/h7-9,11H,3-6H2,1-2H3
InChI key:InChIKey=WVJLAUYHDOVKTD-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(=C(C=C(C=O)C2)C3CC3)OCC1
Synonyms:- 8-Cyclopropyl-4,4-dimethyl-3,4-dihydro-2H-chromene-6-carboxaldehyde
- 2H-1-Benzopyran-6-carboxaldehyde, 8-cyclopropyl-3,4-dihydro-4,4-dimethyl-
- 8-Cyclopropyl-3,4-dihydro-4,4-dimethyl-2H-1-benzopyran-6-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.