CAS 1350761-35-1

8-Chloro-3,4-dihydro-2,2-dimethyl-2H-1-benzopyran-6-carboxaldehyde

Description:

8-Chloro-3,4-dihydro-2,2-dimethyl-2H-1-benzopyran-6-carboxaldehyde is a chemical compound characterized by its complex bicyclic structure, which includes a benzopyran moiety. This compound features a chloro substituent at the 8-position and an aldehyde functional group at the 6-position, contributing to its reactivity and potential applications in organic synthesis. The presence of two methyl groups at the 2-position enhances its steric properties, influencing its interactions with other molecules. The compound is likely to exhibit moderate solubility in organic solvents, while its reactivity may allow it to participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₂H₁₃ClO₂

InChI: InChI=1S/C12H13ClO2/c1-12(2)4-3-9-5-8(7-14)6-10(13)11(9)15-12/h5-7H,3-4H2,1-2H3

InChI key: InChIKey=JXSMTFMTJQTESH-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(C=O)=C1)CCC(C)(C)O2

Synonyms:

• 2H-1-Benzopyran-6-carboxaldehyde, 8-chloro-3,4-dihydro-2,2-dimethyl-
• 8-Chloro-3,4-dihydro-2,2-dimethyl-2H-1-benzopyran-6-carboxaldehyde
• 8-Chloro-2,2-dimethyl-3,4-dihydro-2H-chromene-6-carboxaldehyde