CAS 1350761-55-5

Methyl 2,3-dihydro-2,2-dimethylspiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxylate

Description:

Methyl 2,3-dihydro-2,2-dimethylspiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxylate is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of both benzopyran and cyclopropane. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its interactions in various chemical environments. The spiro structure introduces strain, which can affect the compound's stability and reactivity, making it of interest in synthetic organic chemistry. Additionally, the compound may exhibit interesting biological activities, potentially serving as a lead compound in pharmaceutical research. Its molecular structure suggests potential applications in fields such as medicinal chemistry, agrochemicals, or materials science. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various scientific domains.

Formula: C₁₅H₁₈O₃

InChI: InChI=1S/C15H18O3/c1-14(2)9-15(6-7-15)11-8-10(13(16)17-3)4-5-12(11)18-14/h4-5,8H,6-7,9H2,1-3H3

InChI key: InChIKey=JDQSUDBYWMFXLI-UHFFFAOYSA-N

SMILES: CC1(C)CC2(C=3C(O1)=CC=C(C(OC)=O)C3)CC2

Synonyms:

• Spiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxylic acid, 2,3-dihydro-2,2-dimethyl-, methyl ester
• Methyl 2,3-dihydro-2,2-dimethylspiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxylate