
CAS 1350761-63-5
:8-Cyclopropyl-2,3-dihydro-2,2-dimethylspiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxaldehyde
Description:
8-Cyclopropyl-2,3-dihydro-2,2-dimethylspiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxaldehyde is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of both benzopyran and cyclopropane moieties. This compound features a cyclopropyl group, contributing to its rigidity and potential reactivity. The presence of a carboxaldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The dihydro and dimethyl substitutions suggest that the compound may exhibit interesting steric and electronic properties, influencing its reactivity and interactions with other molecules. Its structural complexity may also impart specific biological activities, making it a candidate for further investigation in medicinal chemistry. Overall, the compound's unique architecture and functional groups position it as a potentially valuable substance in organic synthesis and pharmaceutical applications.
Formula:C17H20O2
InChI:InChI=1S/C17H20O2/c1-16(2)10-17(5-6-17)14-8-11(9-18)7-13(12-3-4-12)15(14)19-16/h7-9,12H,3-6,10H2,1-2H3
InChI key:InChIKey=ZOBNEOZRDGHHTP-UHFFFAOYSA-N
SMILES:CC1(C)CC2(C=3C(=C(C=C(C=O)C3)C4CC4)O1)CC2
Synonyms:- Spiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxaldehyde, 8-cyclopropyl-2,3-dihydro-2,2-dimethyl-
- 8-Cyclopropyl-2,3-dihydro-2,2-dimethylspiro[4H-1-benzopyran-4,1′-cyclopropane]-6-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.