CAS 135095-75-9: (2S,3S,6R,12S,15R)-2,6-Bis(3,4-dihydroxyphenyl)-3,4-dihydro-6,12-methano-2H,12H-1-benzopyrano[5,6-d][1,3]benzodioxocin-3,9,11,13,15-pentol
Description:The chemical substance with the name "(2S,3S,6R,12S,15R)-2,6-Bis(3,4-dihydroxyphenyl)-3,4-dihydro-6,12-methano-2H,12H-1-benzopyrano[5,6-d][1,3]benzodioxocin-3,9,11,13,15-pentol" and CAS number "135095-75-9" is a complex organic compound characterized by multiple hydroxyl groups and a unique bicyclic structure. It belongs to a class of compounds known for their potential biological activities, including antioxidant and anti-inflammatory properties. The presence of multiple phenolic hydroxyl groups contributes to its reactivity and ability to form hydrogen bonds, which may enhance its solubility in polar solvents. The stereochemistry indicated by the specific configuration at various chiral centers suggests that the compound may exhibit specific interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the intricate arrangement of rings and functional groups may contribute to its stability and reactivity, making it of interest in medicinal chemistry and natural product research. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C30H24O12
InChI:InChI=1S/C30H24O12/c31-13-7-19(36)24-23(8-13)41-30(12-2-4-16(33)18(35)6-12)29(39)26(24)25-20(37)10-22-14(28(25)42-30)9-21(38)27(40-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26+,27-,29+,30-/m0/s1
InChI key:InChIKey=SHYPVJZSIOEHJY-VDUQXYFUSA-N
SMILES:OC=1C=C(O)C2=C(OC3(OC4=C5C(OC(C6=CC=C(O)C(O)=C6)C(O)C5)=CC(O)=C4C2C3O)C7=CC=C(O)C(O)=C7)C1
- Synonyms:
- 6,12-Methano-2H,12H-1-benzopyrano[5,6-d][1,3]benzodioxocin-3,9,11,13,15-pentol, 2,6-bis(3,4-dihydroxyphenyl)-3,4-dihydro-, [2S-(2α,3α,6α,12α,15S*)]-
- (2S,3S,6R,12S,15R)-2,6-Bis(3,4-dihydroxyphenyl)-3,4-dihydro-6,12-methano-2H,12H-1-benzopyrano[5,6-d][1,3]benzodioxocin-3,9,11,13,15-pentol
- 6,12-Methano-2H,12H-1-benzopyrano[5,6-d][1,3]benzodioxocin-3,9,11,13,15-pentol, 2,6-bis(3,4-dihydroxyphenyl)-3,4-dihydro-, (2S,3S,6R,12S,15R)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Epicatechin-(2β->5,4β->6)-ent-epicatechin REF: 3D-FE161101CAS: 135095-75-9 | Min. 95% | To inquire | Thu 08 May 25 |

Epicatechin-(2β->5,4β->6)-ent-epicatechin
Ref: 3D-FE161101
Undefined size | To inquire |