CymitQuimica logo

CAS 1350989-07-9

:

1-[(5-Methyl-3-isoxazolyl)carbonyl]-3-azetidinecarboxylic acid

Description:
1-[(5-Methyl-3-isoxazolyl)carbonyl]-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include an azetidine ring and an isoxazole moiety. The presence of the isoxazole ring contributes to its potential biological activity, as this heterocyclic structure is often associated with various pharmacological properties. The compound contains a carboxylic acid functional group, which can influence its solubility and reactivity, making it potentially useful in medicinal chemistry. Its molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which could affect its behavior in biological systems. Additionally, the methyl group on the isoxazole ring may enhance lipophilicity, impacting its absorption and distribution in biological contexts. Overall, this compound's characteristics suggest it may have applications in drug development or as a biochemical probe, although specific biological activities would require further investigation through experimental studies.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-5-2-7(10-15-5)8(12)11-3-6(4-11)9(13)14/h2,6H,3-4H2,1H3,(H,13,14)
InChI key:InChIKey=DCQBXZLSVXKBSF-UHFFFAOYSA-N
SMILES:C(=O)(N1CC(C(O)=O)C1)C=2C=C(C)ON2
Synonyms:
  • 3-Azetidinecarboxylic acid, 1-[(5-methyl-3-isoxazolyl)carbonyl]-
  • 1-[(5-Methyl-3-isoxazolyl)carbonyl]-3-azetidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.