CymitQuimica logo

CAS 1350989-12-6

:

N-(2-Furanylmethyl)-4-(methylthio)-2-benzothiazolamine

Description:
N-(2-Furanylmethyl)-4-(methylthio)-2-benzothiazolamine is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety, a furan ring, and a methylthio group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the furan ring may contribute to its reactivity and ability to participate in various chemical reactions, including electrophilic substitutions. The methylthio group can influence the compound's electronic properties and steric hindrance, potentially affecting its interaction with biological targets. Additionally, compounds of this nature may exhibit antimicrobial, antifungal, or anticancer activities, making them of interest in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, N-(2-Furanylmethyl)-4-(methylthio)-2-benzothiazolamine represents a class of compounds with diverse applications in pharmaceuticals and materials science.
Formula:C13H12N2OS2
InChI:InChI=1S/C13H12N2OS2/c1-17-10-5-2-6-11-12(10)15-13(18-11)14-8-9-4-3-7-16-9/h2-7H,8H2,1H3,(H,14,15)
InChI key:InChIKey=CIWKTEJZACPGSJ-UHFFFAOYSA-N
SMILES:S(C)C1=C2C(SC(NCC3=CC=CO3)=N2)=CC=C1
Synonyms:
  • 2-Benzothiazolamine, N-(2-furanylmethyl)-4-(methylthio)-
  • N-(2-Furanylmethyl)-4-(methylthio)-2-benzothiazolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.