CAS 1350989-16-0
:N-(2-Furanylmethyl)-6-(methylthio)-2-benzothiazolamine
Description:
N-(2-Furanylmethyl)-6-(methylthio)-2-benzothiazolamine is a chemical compound characterized by its unique structural features, which include a benzothiazole core, a furan moiety, and a methylthio group. The presence of the benzothiazole ring contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The furan group, known for its aromaticity and reactivity, may enhance the compound's ability to participate in chemical reactions or interact with biological targets. The methylthio substituent can influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. This compound may exhibit interesting properties such as fluorescence or specific reactivity due to its heterocyclic components. Its potential applications could span medicinal chemistry, where it may serve as a lead compound for drug development, or in materials science, depending on its stability and reactivity. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C13H12N2OS2
InChI:InChI=1S/C13H12N2OS2/c1-17-10-4-5-11-12(7-10)18-13(15-11)14-8-9-3-2-6-16-9/h2-7H,8H2,1H3,(H,14,15)
InChI key:InChIKey=WANUMGJKMKIDTD-UHFFFAOYSA-N
SMILES:N(CC1=CC=CO1)C2=NC=3C(S2)=CC(SC)=CC3
Synonyms:- N-(2-Furanylmethyl)-6-(methylthio)-2-benzothiazolamine
- 2-Benzothiazolamine, N-(2-furanylmethyl)-6-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.