CAS 135101-78-9

adenosine-5-N'-(2,4-dinitro-5-fluorophenyl)phosphohydrazine

Description:

Adenosine-5-N'-(2,4-dinitro-5-fluorophenyl)phosphohydrazine, with the CAS number 135101-78-9, is a chemical compound that features a complex structure incorporating adenosine, a nucleoside composed of adenine and ribose, linked to a phosphohydrazine moiety. This compound is characterized by the presence of a dinitro and fluorinated phenyl group, which contributes to its unique chemical properties and potential biological activity. The dinitro group is known for its electron-withdrawing effects, which can influence the reactivity of the compound, while the fluorine atom can enhance lipophilicity and alter the compound's interaction with biological targets. The phosphohydrazine linkage suggests potential applications in biochemistry, particularly in the context of enzyme inhibition or as a precursor for further chemical modifications. Overall, this compound's structural features may confer interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₆H₁₇FN₉O₁₀P

InChI: InChI=1/C16H17FN9O10P/c17-6-1-7(9(26(31)32)2-8(6)25(29)30)22-23-37(33,34)35-3-10-12(27)13(28)16(36-10)24-5-21-11-14(18)19-4-20-15(11)24/h1-2,4-5,10,12-13,16,22,27-28H,3H2,(H2,18,19,20)(H2,23,33,34)/t10-,12-,13-,16-/m1/s1

SMILES: c1c(c(cc(c1NNP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)N(=O)=O)N(=O)=O)F

Synonyms:

• Dnph-amp
• Adenosine, 5'-(hydrogen 2-(5-fluoro-2,4-dinitrophenyl)phosphorohydrazidate)
• 5'-O-{[2-(5-fluoro-2,4-dinitrophenyl)hydrazino](hydroxy)phosphoryl}adenosine
• Adenosine-5-N'-(2,4-dinitro-5-fluorophenyl)phosphohydrazine