CAS 135112-27-5
:L-2-(fmoc-amino)butyric acid
Description:
L-2-(Fmoc-amino)butyric acid is an amino acid derivative characterized by the presence of a fluorenylmethyloxycarbonyl (Fmoc) protective group attached to the amino group of butyric acid. This compound is typically utilized in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), due to the stability of the Fmoc group under basic conditions, which allows for selective deprotection. The structure features a butyric acid backbone, which contributes to its hydrophobic properties, while the Fmoc group enhances its solubility in organic solvents. L-2-(Fmoc-amino)butyric acid is generally white to off-white in appearance and is soluble in common organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). Its molecular structure allows for the formation of peptides with specific sequences, making it valuable in the fields of biochemistry and medicinal chemistry. Additionally, the compound's stability and reactivity make it a useful building block in the synthesis of more complex molecules.
Formula:C19H19NO4
InChI:InChI=1/C19H19NO4/c20-17(19(22)23)9-10-18(21)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11,20H2,(H,22,23)
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=O)CCC(C(=O)O)N
Synonyms:- Fmoc-L-2-aminobutyric acid
- Fmoc-Abu-OH
- N-alpha-(9-fluorenylmethyloxycarbonyl)-L-2-aminobutyric acid
- 2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid
- (S)-Fmoc-2-aminobutyric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Fmoc-Abu-OH
CAS:<p>Bachem ID: 4006449.</p>Formula:C19H19NO4Purity:99.8%Color and Shape:WhiteMolecular weight:325.36Fmoc-Abu-OH
CAS:Fmoc-Abu-OHFormula:C19H19NO4Purity:98%Color and Shape: white solidMolecular weight:325.36g/molFmoc-Abu-OH
CAS:Formula:C19H19NO4Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:325.36(S)-2-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]butanoic Acid
CAS:Formula:C19H19NO4Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalineMolecular weight:325.36FMOC-2-Aminobutric Acid extrapure, 99%
CAS:Formula:C19H19NO4Purity:min. 99%Color and Shape:White, PowderMolecular weight:325.36Fmoc-L-alpha-aminobutyric acid
CAS:<p>Fmoc-L-alpha-aminobutyric acid is a synthetic amino acid that is used as a linker in solid-phase peptide synthesis. It is also used to synthesize analogs of the serine protease NS3, which are postulated to inhibit hepatitis C virus replication by preventing the release of viral RNA from infected cells. Fmoc-L-alpha-aminobutyric acid has been shown to have anti-viral activity against the influenza virus and HIV.</p>Formula:C19H19NO4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:325.36 g/mol







