CymitQuimica logo

CAS 1351231-77-0

:

N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

Description:
N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a boron-containing moiety. The presence of the diethyl group suggests that it has two ethyl substituents attached to the nitrogen atom, which can influence its solubility and reactivity. The tetramethyl-1,3,2-dioxaborolane group contributes to its potential applications in organic synthesis and medicinal chemistry, particularly in the context of boron chemistry, where boron compounds are often utilized for their ability to form stable complexes and participate in various chemical reactions. This compound may exhibit properties such as moderate polarity, making it soluble in organic solvents, and it could also demonstrate biological activity due to the pyridinamine structure. Its specific applications and reactivity would depend on the functional groups and the overall molecular architecture, which can be explored further in synthetic and pharmaceutical contexts.
Formula:C15H25BN2O2
InChI:InChI=1S/C15H25BN2O2/c1-7-18(8-2)13-11-12(9-10-17-13)16-19-14(3,4)15(5,6)20-16/h9-11H,7-8H2,1-6H3
InChI key:InChIKey=VHOPEIZUZKRUND-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(N(CC)CC)N=CC2
Synonyms:
  • N,N-Diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
  • 2-Pyridinamine, N,N-diethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.