CAS 135124-70-8

3-(Aminomethyl)-5-bromopyridine

Description:

3-(Aminomethyl)-5-bromopyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and an aminomethyl group at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry and organic synthesis. This compound typically appears as a solid and is soluble in polar organic solvents. Its molecular structure allows for various functionalization reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The amino group can participate in nucleophilic reactions, while the bromine atom can serve as a leaving group in substitution reactions. Additionally, the compound may exhibit biological activity, which can be explored in drug discovery contexts. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 3-(Aminomethyl)-5-bromopyridine is a versatile building block in organic chemistry.

Formula: C₆H₇BrN₂

InChI: InChI=1/C6H7BrN2/c7-6-1-5(2-8)3-9-4-6/h1,3-4H,2,8H2

SMILES: c1c(CN)cncc1Br

Synonyms:

• (5-Bromo-3-Pyridinyl)Methylamine
• 5-Bromo-3-Pyridinemethanamine
• 5-Bromo-3-Pyridinemethylamine
• 1-(5-Bromopyridin-3-Yl)Methanamine

(5-Bromo-3-pyridinyl)methylamine

CAS: 135124-70-8

Formula: C₆H₇BrN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 187.0372

Ref: IN-DA003849

3-(Aminomethyl)-5-bromopyridine

CAS: 135124-70-8

3-(Aminomethyl)-5-bromopyridine

Formula: C₆H₇BrN₂

Purity: 98%

Color and Shape: red liquid

Molecular weight: 187.04g/mol

Ref: 54-OR14911

5-Bromo-3-pyridinemethylamine

CAS: 135124-70-8

Formula: C₆H₇BrN₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 187.04

Ref: 10-F048850