CAS 135127-54-7

Ethyl 1-(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-4-piperidinecarboxylate

Description:

Ethyl 1-(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-4-piperidinecarboxylate, with CAS number 135127-54-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a naphthalene moiety. The presence of a chloro substituent and a dioxo functional group contributes to its reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific functional groups and their interactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both a piperidine and a naphthalene derivative, which are common in bioactive compounds. Additionally, the compound's unique features may influence its pharmacokinetics and pharmacodynamics, making it a subject of interest for further research in drug development and synthesis.

Formula: C₁₈H₁₈ClNO₄

InChI: InChI=1S/C18H18ClNO4/c1-2-24-18(23)11-7-9-20(10-8-11)15-14(19)16(21)12-5-3-4-6-13(12)17(15)22/h3-6,11H,2,7-10H2,1H3

InChI key: InChIKey=ZCMSHFUPDHQEHF-UHFFFAOYSA-N

SMILES: O=C1C(=C(Cl)C(=O)C=2C1=CC=CC2)N3CCC(C(OCC)=O)CC3

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-, ethyl ester
• Ethyl 1-(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-4-piperidinecarboxylate