CAS 135131-00-9

2-phenyl-3,3a-dihydropyrazolo[1,5-d][1,2,4]triazin-4(5H)-one

Description:

2-Phenyl-3,3a-dihydropyrazolo[1,5-d][1,2,4]triazin-4(5H)-one is a heterocyclic compound characterized by its unique pyrazolo-triazine structure, which incorporates both nitrogen and carbon atoms in a fused ring system. This compound features a phenyl group, contributing to its aromatic properties and potential for various chemical interactions. It typically exhibits moderate solubility in organic solvents, which can vary based on the solvent's polarity. The presence of the triazine moiety often imparts biological activity, making such compounds of interest in medicinal chemistry for their potential pharmacological properties. Additionally, the compound may display specific reactivity patterns due to the functional groups present, influencing its behavior in chemical reactions. Its CAS number, 135131-00-9, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, 2-phenyl-3,3a-dihydropyrazolo[1,5-d][1,2,4]triazin-4(5H)-one represents a complex and intriguing structure within the realm of organic chemistry.

Formula: C₁₁H₁₀N₄O

InChI: InChI=1/C11H10N4O/c16-11-10-6-9(8-4-2-1-3-5-8)14-15(10)7-12-13-11/h1-5,7,10H,6H2,(H,13,16)

SMILES: c1ccc(cc1)C1=NN2C=NN=C(C2C1)O

Synonyms:

• Pyrazolo[1,5-D][1,2,4]Triazin-4-Ol, 3,3A-Dihydro-2-Phenyl-