
CAS 1351337-49-9
:2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzenamine
Description:
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzenamine, identified by its CAS number 1351337-49-9, is a chemical compound that features a complex structure incorporating both a dioxaborolane moiety and a trifluoromethyl-substituted aniline. The presence of the dioxaborolane group suggests potential applications in organic synthesis, particularly in cross-coupling reactions, due to its ability to participate in boron-based chemistry. The trifluoromethyl group enhances the compound's lipophilicity and may influence its electronic properties, making it of interest in medicinal chemistry and materials science. This compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity would depend on the surrounding chemical environment. Its unique structural features may also impart specific biological activities or interactions, warranting further investigation in pharmacological contexts. Overall, this compound represents a valuable building block in the development of novel materials and pharmaceuticals.
Formula:C13H17BF3NO2
InChI:InChI=1S/C13H17BF3NO2/c1-11(2)12(3,4)20-14(19-11)10-8(13(15,16)17)6-5-7-9(10)18/h5-7H,18H2,1-4H3
InChI key:InChIKey=UYOGSDVEVIQAHW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(B2OC(C)(C)C(C)(C)O2)C(N)=CC=C1
Synonyms:- 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)benzenamine
- Benzenamine, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenamine, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-
CAS:Formula:C13H17BF3NO2Molecular weight:287.0858
