
CAS 1351345-64-6
:(3S)-Tetrahydro-3-furansulfonyl chloride
Description:
(3S)-Tetrahydro-3-furansulfonyl chloride is a chemical compound characterized by its unique structure, which includes a tetrahydrofuran ring and a sulfonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the sulfonyl chloride moiety, which can act as a potent electrophile in various chemical reactions. It is often utilized in organic synthesis, particularly in the formation of sulfonamides and other derivatives. The stereochemistry indicated by the (3S) designation suggests that it has a specific three-dimensional arrangement, which can influence its reactivity and interactions with other molecules. Safety precautions are essential when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, (3S)-Tetrahydro-3-furansulfonyl chloride is a valuable intermediate in synthetic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C4H7ClO3S
InChI:InChI=1S/C4H7ClO3S/c5-9(6,7)4-1-2-8-3-4/h4H,1-3H2/t4-/m0/s1
InChI key:InChIKey=MVZIUOJNVVIOEY-BYPYZUCNSA-N
SMILES:S(Cl)(=O)(=O)[C@H]1CCOC1
Synonyms:- 3-Furansulfonyl chloride, tetrahydro-, (3S)-
- (3S)-Tetrahydro-3-furansulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.