CAS 135135-87-4

DuP 734

Description:

DuP 734, with the CAS number 135135-87-4, is a chemical compound that has been studied primarily for its potential applications in pharmacology. It is known as a selective antagonist of the angiotensin II receptor, specifically targeting the AT1 subtype. This characteristic makes it relevant in the context of cardiovascular research, particularly in the treatment of hypertension and heart failure. DuP 734 exhibits a high affinity for the receptor, which allows it to effectively block the actions of angiotensin II, a peptide that plays a crucial role in regulating blood pressure and fluid balance. The compound's structure includes specific functional groups that contribute to its biological activity and selectivity. Additionally, DuP 734 has been investigated for its effects on various physiological processes, including vascular smooth muscle contraction and aldosterone secretion. As with many pharmacological agents, understanding its pharmacokinetics, metabolism, and potential side effects is essential for evaluating its therapeutic potential.

Formula: C₁₇H₂₃BrFNO

InChI: InChI=1/C17H22FNO.BrH/c18-16-5-3-15(4-6-16)17(20)11-13-7-9-19(10-8-13)12-14-1-2-14;/h3-6,13-14H,1-2,7-12H2;1H

SMILES: C1CC1CN1CCC(CC1)CC(=O)c1ccc(cc1)F.Br

Synonyms:

• 1-(Cyclopropylmethyl)-4-(2'-(4''-fluorophenyl)-2'-oxoethyl)piperidine
• Ethanone, 2-(1-(cyclopropylmethyl)-4-piperidinyl)-1-(4-fluorophenyl)-, hydrobromide
• 2-[1-(Cyclopropylmethyl)Piperidin-4-Yl]-1-(4-Fluorophenyl)Ethanone Hydrobromide (1:1)
• Dup-734

DuP 734

CAS: 135135-87-4

DuP 734 is a potent and selective sigma receptor antagonist, functioning as a ligand for both sigma and 5-HT2 receptors, and exhibiting weak affinity towards D2 receptors. It possesses potential antipsychotic activity, potentially devoid of the motor side effects commonly observed with neuroleptics[1][2][3].

Formula: C₁₇H₂₃BrFNO

Color and Shape: Solid

Molecular weight: 356.279

Ref: TM-T37074