CAS 1351373-48-2

4,7,10,13,16,19,22,25,28,31,34-Undecaoxaheptatriaconta-1,36-diyne

Description:

4,7,10,13,16,19,22,25,28,31,34-Undecaoxaheptatriaconta-1,36-diyne is a complex organic compound characterized by its long carbon chain and multiple ether linkages, indicated by the presence of eleven oxygen atoms in its structure. This compound features a unique arrangement of alkyne functional groups, which contributes to its potential reactivity and applications in materials science and organic synthesis. The presence of multiple ether groups suggests that it may exhibit properties such as solubility in organic solvents and potential use as a surfactant or in polymer chemistry. The lengthy carbon backbone may also impart flexibility and influence the compound's physical properties, such as melting and boiling points. Additionally, the specific arrangement of functional groups can affect its chemical behavior, making it of interest for research in fields like nanotechnology and drug delivery systems. Overall, this compound's structural complexity and functional diversity make it a subject of interest for various chemical applications.

Formula: C₂₆H₄₆O₁₁

InChI: InChI=1S/C26H46O11/c1-3-5-27-7-9-29-11-13-31-15-17-33-19-21-35-23-25-37-26-24-36-22-20-34-18-16-32-14-12-30-10-8-28-6-4-2/h1-2H,5-26H2

InChI key: InChIKey=YGYWDYNYLJLYTA-UHFFFAOYSA-N

SMILES: O(CCOCCOCCOCCOCCOCC#C)CCOCCOCCOCCOCCOCC#C

Synonyms:

• 4,7,10,13,16,19,22,25,28,31,34-Undecaoxaheptatriaconta-1,36-diyne

Bis-propargyl-PEG10

CAS: 1351373-48-2

Bis-propargyl-PEG10 is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₂₆H₄₆O₁₁

Color and Shape: Solid

Molecular weight: 534.643

Ref: TM-T38749