CAS 1351398-06-5

5-Methyl-1-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]-1H-pyrazole-4-carboxylic acid

Description:

5-Methyl-1-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a pyridine moiety, and an oxadiazole group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including hydrogen bonding and coordination with metal ions. Its molecular structure indicates potential for interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many heterocyclic compounds, it may also exhibit unique spectroscopic characteristics, making it identifiable through techniques such as NMR and mass spectrometry. Overall, this compound represents a class of molecules that could have significant implications in medicinal chemistry and related fields.

Formula: C₁₃H₁₁N₅O₃

InChI: InChI=1S/C13H11N5O3/c1-7-10(13(19)20)6-15-18(7)11-4-3-9(5-14-11)12-16-8(2)17-21-12/h3-6H,1-2H3,(H,19,20)

InChI key: InChIKey=ILSMXLPSLIYOOJ-UHFFFAOYSA-N

SMILES: CC=1N(N=CC1C(O)=O)C2=CC=C(C=N2)C3=NC(C)=NO3

Synonyms:

• 5-Methyl-1-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 5-methyl-1-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]-