CymitQuimica logo

CAS 1351398-31-6

:

Methyl 1-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-1H-1,2,3-triazole-4-carboxylate

Description:
Methyl 1-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-1H-1,2,3-triazole-4-carboxylate is a chemical compound characterized by its complex structure, which includes a triazole ring and an isoindole derivative. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the triazole moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to form hydrogen bonds and participate in various chemical reactions. The isoindole component may impart additional biological activity, making it of interest in drug discovery. The compound's molecular weight, solubility, and stability can vary depending on environmental conditions and the presence of other functional groups. Overall, this substance exemplifies the intricate interplay of structural features that can influence its chemical behavior and potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C14H12N4O4
InChI:InChI=1S/C14H12N4O4/c1-22-14(21)11-8-17(16-15-11)6-7-18-12(19)9-4-2-3-5-10(9)13(18)20/h2-5,8H,6-7H2,1H3
InChI key:InChIKey=JKJFWSCPZVOICJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCN3C=C(C(OC)=O)N=N3)=CC=CC2
Synonyms:
  • 1H-1,2,3-Triazole-4-carboxylic acid, 1-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-, methyl ester
  • Methyl 1-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl]-1H-1,2,3-triazole-4-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.