CAS 1351398-32-7

2-(4-Butoxyphenyl)pyrazolo[1,5-a]pyrazin-4(5H)-one

Description:

2-(4-Butoxyphenyl)pyrazolo[1,5-a]pyrazin-4(5H)-one is a chemical compound characterized by its unique pyrazolo and pyrazinone structures, which contribute to its potential biological activity. The presence of the butoxyphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. This compound may exhibit properties such as anti-inflammatory, analgesic, or other pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure includes a pyrazolo ring fused to a pyrazinone moiety, which can participate in various chemical reactions, including hydrogen bonding and π-π stacking interactions. The compound's stability, reactivity, and biological activity can be influenced by the substituents on the aromatic rings and the overall electronic distribution within the molecule. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its potential applications in drug development or as a research tool in biochemical studies. Further investigation into its properties and mechanisms of action would be necessary to fully understand its utility in various fields.

Formula: C₁₆H₁₇N₃O₂

InChI: InChI=1S/C16H17N3O2/c1-2-3-10-21-13-6-4-12(5-7-13)14-11-15-16(20)17-8-9-19(15)18-14/h4-9,11H,2-3,10H2,1H3,(H,17,20)

InChI key: InChIKey=NXESDLFFFIHWEW-UHFFFAOYSA-N

SMILES: O=C1C2=CC(=NN2C=CN1)C3=CC=C(OCCCC)C=C3

Synonyms:

• 2-(4-Butoxyphenyl)pyrazolo[1,5-a]pyrazin-4(5H)-one
• Pyrazolo[1,5-a]pyrazin-4(5H)-one, 2-(4-butoxyphenyl)-