CAS 1351398-83-8

2-Hydroxyacetic acid 2-[(ethylamino)thioxomethyl]hydrazide

Description:

2-Hydroxyacetic acid 2-[(ethylamino)thioxomethyl]hydrazide, identified by its CAS number 1351398-83-8, is a chemical compound that features a hydrazide functional group, which is characterized by the presence of a hydrazine moiety attached to a carboxylic acid derivative. This compound typically exhibits properties associated with both hydrazides and thioxomethyl groups, potentially influencing its reactivity and interactions in various chemical environments. The presence of the hydroxy group suggests it may engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the ethylamino group may impart basicity, affecting its behavior in acid-base reactions. The thioxomethyl moiety can introduce unique reactivity patterns, possibly making it a candidate for various synthetic applications or biological activities. Overall, the compound's characteristics, including its molecular structure and functional groups, suggest potential utility in medicinal chemistry or as an intermediate in organic synthesis, although specific applications would depend on further empirical studies.

Formula: C₅H₁₁N₃O₂S

InChI: InChI=1S/C5H11N3O2S/c1-2-6-5(11)8-7-4(10)3-9/h9H,2-3H2,1H3,(H,7,10)(H2,6,8,11)

InChI key: InChIKey=QHUSJBURJKATPO-UHFFFAOYSA-N

SMILES: N(NC(CO)=O)C(NCC)=S

Synonyms:

• 2-Hydroxyacetic acid 2-[(ethylamino)thioxomethyl]hydrazide
• Acetic acid, 2-hydroxy-, 2-[(ethylamino)thioxomethyl]hydrazide