
CAS 1351399-14-8
:2-(2-Butoxyphenyl)pyrazolo[1,5-a]pyrazin-4(5H)-one
Description:
2-(2-Butoxyphenyl)pyrazolo[1,5-a]pyrazin-4(5H)-one is a chemical compound characterized by its unique structure, which includes a pyrazolo[1,5-a]pyrazin core fused with a butoxyphenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its complex ring structure. It may possess moderate to high lipophilicity, influencing its solubility in organic solvents and its interaction with biological membranes. The presence of the butoxy group can enhance its stability and affect its reactivity, making it a candidate for various applications in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. As with many pyrazole derivatives, it may also show potential pharmacological properties, warranting further investigation into its therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C16H17N3O2
InChI:InChI=1S/C16H17N3O2/c1-2-3-10-21-15-7-5-4-6-12(15)13-11-14-16(20)17-8-9-19(14)18-13/h4-9,11H,2-3,10H2,1H3,(H,17,20)
InChI key:InChIKey=AYOUHHIAKZECJY-UHFFFAOYSA-N
SMILES:O(CCCC)C1=C(C=2C=C3N(N2)C=CNC3=O)C=CC=C1
Synonyms:- Pyrazolo[1,5-a]pyrazin-4(5H)-one, 2-(2-butoxyphenyl)-
- 2-(2-Butoxyphenyl)pyrazolo[1,5-a]pyrazin-4(5H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.