CAS 135145-90-3
:2,5-Dichlorobenzeneboronic acid
Description:
2,5-Dichlorobenzeneboronic acid is an organoboron compound characterized by the presence of both boronic acid and dichlorobenzene functional groups. It typically appears as a white to off-white solid and is soluble in polar organic solvents. The compound features a boronic acid group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The dichlorobenzene moiety contributes to its chemical stability and reactivity, allowing for potential use in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds. Additionally, the presence of chlorine atoms can influence the electronic properties and reactivity of the compound, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety considerations should be taken into account due to the potential toxicity of chlorinated compounds. Overall, 2,5-Dichlorobenzeneboronic acid is a versatile compound with significant utility in synthetic organic chemistry.
Formula:C6H5BCl2O2
InChI:InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H
SMILES:c1cc(c(cc1Cl)B(O)O)Cl
Synonyms:- 2,5-Dichlorophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,5-Dichlorobenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H5BCl2O2Purity:98%Color and Shape:White, PowderMolecular weight:190.81Boronic acid, (2,5-dichlorophenyl)-
CAS:Formula:C6H5BCl2O2Purity:98%Color and Shape:SolidMolecular weight:190.81972,5-Dichlorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BCl2O2Purity:97.0 to 111.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:190.812,5-Dichlorobenzeneboronic acid
CAS:2,5-Dichlorobenzeneboronic acidFormula:C6H5BCl2O2Purity:98%Color and Shape: white solidMolecular weight:190.82g/mol2,5-Dichlorophenylboronic acid
CAS:Formula:C6H5BCl2O2Purity:98%Color and Shape:CrystallineMolecular weight:190.812,5-Dichlorophenylboronic Acid
CAS:Controlled ProductFormula:C6H5BCl2O2Color and Shape:NeatMolecular weight:190.82






