CAS 1351479-10-1

1,2-Cyclohexanediamine, N1,N2-dimethyl-, hydrochloride (1:2)

Description:

1,2-Cyclohexanediamine, N1,N2-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its cyclic structure and the presence of two amine groups. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water compared to its free base. The compound features two methyl groups attached to the nitrogen atoms of the cyclohexanediamine backbone, which can influence its reactivity and interaction with biological systems. It is often used in various applications, including organic synthesis and as a building block in pharmaceuticals. The presence of the hydrochloride indicates that it can act as a proton donor, making it a weak base. Its structural characteristics contribute to its potential as a ligand in coordination chemistry and its utility in the development of new materials. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₈H₁₈N₂·2ClH

InChI: InChI=1S/C8H18N2.2ClH/c1-9-7-5-3-4-6-8(7)10-2;;/h7-10H,3-6H2,1-2H3;2*1H

InChI key: InChIKey=UDYXZFBJGBDHHP-UHFFFAOYSA-N

SMILES: N(C)C1C(NC)CCCC1.Cl

Synonyms:

• 1,2-Cyclohexanediamine, N1,N2-dimethyl-, hydrochloride (1:2)

N1,N2-Dimethylcyclohexane-1,2-diamine dihydrochloride

CAS: 1351479-10-1

Formula: C₈H₂₀Cl₂N₂

Molecular weight: 215.1638

Ref: IN-DA019FXX