
CAS 1351499-17-6
:Piperidine, 4-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)
Description:
Piperidine, 4-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a cyclobutyl group and a 1,2,4-oxadiazole moiety, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the oxadiazole ring suggests potential for various interactions in biological systems, making it of interest in medicinal chemistry. Its molecular structure may impart specific pharmacological properties, including potential antimicrobial or anti-inflammatory effects. The compound's stability, solubility, and reactivity can be influenced by the pH of the environment, and it may exhibit different behaviors in various solvents. Overall, this compound represents a unique combination of structural features that may be explored for therapeutic applications.
Formula:C11H17N3O·ClH
InChI:InChI=1S/C11H17N3O.ClH/c1-2-8(3-1)10-13-11(15-14-10)9-4-6-12-7-5-9;/h8-9,12H,1-7H2;1H
InChI key:InChIKey=VJJANOJYTFLNRY-UHFFFAOYSA-N
SMILES:C=1(N=C(ON1)C2CCNCC2)C3CCC3.Cl
Synonyms:- Piperidine, 4-(3-cyclobutyl-1,2,4-oxadiazol-5-yl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.