CAS 13515-65-6
:2-Methylpropanethioamide
Description:
2-Methylpropanethioamide, also known as isobutylthioamide, is an organic compound characterized by the presence of a thioamide functional group (-C(S)NH2) attached to a branched alkyl chain. Its molecular structure features a methyl group and a propyl group, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic alkyl chain. 2-Methylpropanethioamide is known for its potential applications in organic synthesis and as an intermediate in the production of various chemicals. It may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many thioamides, it should be handled with care due to potential toxicity and irritant properties. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability and integrity.
Formula:C4H9NS
InChI:InChI=1/C4H9NS/c1-3(2)4(5)6/h3H,1-2H3,(H2,5,6)
SMILES:CC(C)C(=N)S
Synonyms:- Dimethylthioacetamid
- Dimethylthioacetamide
- Propanethioamide, 2-methyl-
- 2-Methylpropanethioamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Thioisobutyramide, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C4H9NSPurity:95%Molecular weight:103.182-Methylpropanethioamide
CAS:Formula:C4H9NSPurity:97%Color and Shape:Liquid, OilMolecular weight:103.18
