CymitQuimica logo

CAS 13515-74-7

:

methyl 1-tritylprolinate

Description:
Methyl 1-tritylprolinate is an organic compound characterized by its structure, which includes a proline derivative with a trityl group and a methyl ester functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethyl acetate, but less soluble in water due to its hydrophobic trityl group. The presence of the trityl group enhances its stability and can influence its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. Methyl 1-tritylprolinate can serve as a chiral building block in the synthesis of pharmaceuticals and other biologically active compounds. Its properties, such as melting point and boiling point, can vary based on purity and specific conditions. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C25H25NO2
InChI:InChI=1/C25H25NO2/c1-28-24(27)23-18-11-19-26(23)25(20-12-5-2-6-13-20,21-14-7-3-8-15-21)22-16-9-4-10-17-22/h2-10,12-17,23H,11,18-19H2,1H3
SMILES:COC(=O)C1CCCN1C(c1ccccc1)(c1ccccc1)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.