CAS 1351516-02-3

2-Methyl-8-nitro-7-quinolinamine

Description:

2-Methyl-8-nitro-7-quinolinamine is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This specific compound features a methyl group at the second position and a nitro group at the eighth position of the quinoline ring, along with an amino group at the seventh position. These functional groups contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the nitro group typically enhances the compound's electrophilic character, making it useful in synthetic organic chemistry. Additionally, the amino group can participate in hydrogen bonding and may influence the compound's solubility and interaction with biological targets. The compound's unique structure may also impart specific biological activities, making it of interest for research in medicinal chemistry. As with many nitro-containing compounds, safety precautions should be observed due to potential toxicity and environmental concerns.

Formula: C₁₀H₉N₃O₂

InChI: InChI=1S/C10H9N3O2/c1-6-2-3-7-4-5-8(11)10(13(14)15)9(7)12-6/h2-5H,11H2,1H3

InChI key: InChIKey=IRINVSPFFGRSFV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C2=C(C=CC1N)C=CC(C)=N2

Synonyms:

• 7-Quinolinamine, 2-methyl-8-nitro-
• 2-Methyl-8-nitroquinoline-7-amine
• 2-Methyl-8-nitro-7-quinolinamine