
CAS 1351516-06-7
:Pyrido[2,3-f]quinoxaline-9-carboxaldehyde
Description:
Pyrido[2,3-f]quinoxaline-9-carboxaldehyde is a heterocyclic organic compound characterized by its fused pyridine and quinoxaline rings, which contribute to its unique chemical properties. This compound features a carboxaldehyde functional group, making it reactive and capable of participating in various chemical reactions, such as nucleophilic additions and condensation reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of nitrogen atoms in its structure can influence its electronic properties, potentially making it a candidate for applications in pharmaceuticals, agrochemicals, or materials science. Additionally, its structural complexity may allow for interesting interactions with biological targets, which could be explored in medicinal chemistry. As with many heterocycles, the compound may exhibit fluorescence or other photophysical properties, depending on its specific environment and substituents. Safety and handling precautions should be observed, as with any chemical substance, particularly those with reactive functional groups.
Formula:C12H7N3O
InChI:InChI=1S/C12H7N3O/c16-7-9-3-1-8-2-4-10-12(11(8)15-9)14-6-5-13-10/h1-7H
InChI key:InChIKey=VIYZBHRARIVLOX-UHFFFAOYSA-N
SMILES:C(=O)C1=NC2=C3C(=CC=C2C=C1)N=CC=N3
Synonyms:- Pyrido[2,3-f]quinoxaline-9-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.