
CAS 1351522-05-8: 2-Pyridinecarboxamide, N-[4-[[[[5-(1,1-dimethylethyl)-3-isoxazolyl]amino]carbonyl]amino]phenyl]-5-[(1-ethyl-2,2,6,6-tetramethyl-4-piperidinyl)oxy]-, methanesulfonate (1:1)
Description:2-Pyridinecarboxamide, N-[4-[[[[5-(1,1-dimethylethyl)-3-isoxazolyl]amino]carbonyl]amino]phenyl]-5-[(1-ethyl-2,2,6,6-tetramethyl-4-piperidinyl)oxy]-, methanesulfonate (1:1) is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amides, isoxazoles, and piperidines. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The presence of the methanesulfonate moiety suggests it may have solubility properties that enhance its bioavailability. The compound's structure indicates it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of bulky groups like tert-butyl and ethyl substituents may influence its pharmacokinetic properties, such as absorption and distribution. Overall, this compound exemplifies the complexity often found in drug candidates, where multiple functional groups are designed to optimize efficacy and minimize side effects.
Formula:C31H42N6O4·CH4O3S
InChI:InChI=1S/C31H42N6O4.CH4O3S/c1-9-37-30(5,6)17-23(18-31(37,7)8)40-22-14-15-24(32-19-22)27(38)33-20-10-12-21(13-11-20)34-28(39)35-26-16-25(41-36-26)29(2,3)4;1-5(2,3)4/h10-16,19,23H,9,17-18H2,1-8H3,(H,33,38)(H2,34,35,36,39);1H3,(H,2,3,4)
InChI key:InChIKey=AUMMSMBRVDYUME-UHFFFAOYSA-N
SMILES:O=C(NC1=NOC(=C1)C(C)(C)C)NC2=CC=C(C=C2)NC(=O)C3=NC=C(OC4CC(N(CC)C(C)(C)C4)(C)C)C=C3.O=S(=O)(O)C
- Synonyms:
- 2-Pyridinecarboxamide, N-[4-[[[[5-(1,1-dimethylethyl)-3-isoxazolyl]amino]carbonyl]amino]phenyl]-5-[(1-ethyl-2,2,6,6-tetramethyl-4-piperidinyl)oxy]-, methanesulfonate (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ac710 mesylate REF: 3D-BEC52205CAS: 1351522-05-8 | Min. 95% | 331.00 €~2,477.00 € | Tue 27 May 25 |
![]() | AC710 Mesylate REF: TM-T10228CAS: 1351522-05-8 | 98% | 908.00 €~2,375.00 € | Tue 03 Jun 25 |

Ac710 mesylate
Ref: 3D-BEC52205
1mg | 331.00 € | ||
5mg | 593.00 € | ||
10mg | 900.00 € | ||
25mg | 1,590.00 € | ||
50mg | 2,477.00 € |

AC710 Mesylate
Ref: TM-T10228
25mg | 1,444.00 € | ||
50mg | 1,882.00 € | ||
100mg | 2,375.00 € |