CAS 1351522-05-8

2-Pyridinecarboxamide, N-[4-[[[[5-(1,1-dimethylethyl)-3-isoxazolyl]amino]carbonyl]amino]phenyl]-5-[(1-ethyl-2,2,6,6-tetramethyl-4-piperidinyl)oxy]-, methanesulfonate (1:1)

Description:

2-Pyridinecarboxamide, N-[4-[[[[5-(1,1-dimethylethyl)-3-isoxazolyl]amino]carbonyl]amino]phenyl]-5-[(1-ethyl-2,2,6,6-tetramethyl-4-piperidinyl)oxy]-, methanesulfonate (1:1) is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amides, isoxazoles, and piperidines. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The presence of the methanesulfonate moiety suggests it may have solubility properties that enhance its bioavailability. The compound's structure indicates it may interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of bulky groups like tert-butyl and ethyl substituents may influence its pharmacokinetic properties, such as absorption and distribution. Overall, this compound exemplifies the complexity often found in drug candidates, where multiple functional groups are designed to optimize efficacy and minimize side effects.

Formula: C₃₁H₄₂N₆O₄·CH₄O₃S

InChI: InChI=1S/C31H42N6O4.CH4O3S/c1-9-37-30(5,6)17-23(18-31(37,7)8)40-22-14-15-24(32-19-22)27(38)33-20-10-12-21(13-11-20)34-28(39)35-26-16-25(41-36-26)29(2,3)4;1-5(2,3)4/h10-16,19,23H,9,17-18H2,1-8H3,(H,33,38)(H2,34,35,36,39);1H3,(H,2,3,4)

InChI key: InChIKey=AUMMSMBRVDYUME-UHFFFAOYSA-N

SMILES: O(C1CC(C)(C)N(CC)C(C)(C)C1)C=2C=CC(C(NC3=CC=C(NC(NC=4C=C(C(C)(C)C)ON4)=O)C=C3)=O)=NC2.S(C)(=O)(=O)O

Synonyms:

• 2-Pyridinecarboxamide, N-[4-[[[[5-(1,1-dimethylethyl)-3-isoxazolyl]amino]carbonyl]amino]phenyl]-5-[(1-ethyl-2,2,6,6-tetramethyl-4-piperidinyl)oxy]-, methanesulfonate (1:1)

Ac710 mesylate

CAS: 1351522-05-8

Ac710 mesylate is a small molecule that is being developed for the treatment of fibrosis. It blocks the activity of collagen-specific TGF-β1 and TGF-β3, which are cytokines that function as signaling molecules in fibrosis. Ac710 mesylate has been shown to inhibit alveolar type II cell proliferation and induce lung fibrosis in mice. The drug was also shown to prevent emphysema development in rats with chronic bronchitis, by reducing protein expression and neutrophil infiltration.

Formula: C₃₂H₄₆N₆O₇S

Purity: Min. 95%

Molecular weight: 658.8 g/mol

Ref: 3D-BEC52205

AC710 Mesylate

CAS: 1351522-05-8

AC710 Mesylate is a potent PDGFR inhibitor (Kds: 0.6, 1.57, 1, 1.3, 1.0 nM for FLT3, CSF1R, KIT, PDGFRα and PDGFRβ).

Formula: C₃₂H₄₆N₆O₇S

Purity: 98%

Color and Shape: Solid

Molecular weight: 658.81

Ref: TM-T10228