
CAS 1351564-23-2
:rel-(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-amine
Description:
Rel-(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-amine is a chemical compound characterized by its bicyclic structure, which includes an indene framework. This compound features a secondary amine group, contributing to its reactivity and potential biological activity. The stereochemistry indicated by the "rel-(1R,2S)" notation suggests specific spatial arrangements of the substituents around the chiral centers, which can significantly influence the compound's properties and interactions. The presence of two methyl groups at the 2 and 6 positions of the indene ring enhances its hydrophobic character, potentially affecting its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could relate to various pharmacological activities. However, detailed studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential applications in drug development or other fields. As with many amines, it may also exhibit basicity, allowing it to participate in acid-base reactions.
Formula:C11H15N
InChI:InChI=1/C11H15N/c1-7-3-4-9-6-8(2)11(12)10(9)5-7/h3-5,8,11H,6,12H2,1-2H3/t8-,11+/s2
InChI key:InChIKey=NMRCYNVWDPJOAC-NZXDKVMZNA-N
SMILES:N[C@@H]1C=2C(C[C@H]1C)=CC=C(C)C2
Synonyms:- 1H-Inden-1-amine, 2,3-dihydro-2,6-dimethyl-, (1R,2S)-rel-
- rel-(1R,2S)-2,3-Dihydro-2,6-dimethyl-1H-inden-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.