CymitQuimica logo

CAS 135159-28-3

:

N-[(6-Chloro-3-pyridinyl)methyl]-N,N′-diethyl-2-nitro-1,1-ethenediamine

Description:
N-[(6-Chloro-3-pyridinyl)methyl]-N,N′-diethyl-2-nitro-1,1-ethenediamine, with the CAS number 135159-28-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a nitro group, and an ethylenediamine moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the pyridine and nitro groups, which can influence its reactivity and solubility. It may be utilized in various applications, including pharmaceuticals or agrochemicals, owing to its potential as a bioactive agent. The presence of chlorine in the structure can enhance its lipophilicity, affecting its interaction with biological systems. Additionally, the diethyl substituents may contribute to its steric properties, influencing its binding affinity to target molecules. As with many nitrogen-containing compounds, it may also exhibit basicity, which can affect its behavior in different pH environments. Safety and handling precautions are essential due to the potential toxicity associated with nitro compounds.
Formula:C12H17ClN4O2
InChI:InChI=1S/C12H17ClN4O2/c1-3-14-12(9-17(18)19)16(4-2)8-10-5-6-11(13)15-7-10/h5-7,9,14H,3-4,8H2,1-2H3
InChI key:InChIKey=UWUBCNHLPBVFPV-UHFFFAOYSA-N
SMILES:N(C(=CN(=O)=O)NCC)(CC=1C=CC(Cl)=NC1)CC
Synonyms:
  • 1,1-Ethenediamine, N-[(6-chloro-3-pyridinyl)methyl]-N,N′-diethyl-2-nitro-
  • N-[(6-Chloro-3-pyridinyl)methyl]-N,N′-diethyl-2-nitro-1,1-ethenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.