CAS 1351647-28-3
:N-[4-(3,4-Dihydro-2(1H)-isoquinolinyl)-2-butyn-1-yl]methanesulfonamide
Description:
N-[4-(3,4-Dihydro-2(1H)-isoquinolinyl)-2-butyn-1-yl]methanesulfonamide is a chemical compound characterized by its unique structure, which includes a sulfonamide functional group and an isoquinoline moiety. This compound features a butynyl chain that contributes to its reactivity and potential biological activity. The presence of the isoquinoline structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The sulfonamide group is known for its antibacterial properties and can also influence the compound's solubility and pharmacokinetics. The compound's molecular framework may allow for various substitutions, potentially leading to derivatives with enhanced efficacy or selectivity. Its CAS number, 1351647-28-3, allows for precise identification in chemical databases. Overall, this compound's characteristics suggest it may have applications in drug development, particularly in areas targeting neurological or infectious diseases, although specific biological activities would require further investigation through experimental studies.
Formula:C14H18N2O2S
InChI:InChI=1S/C14H18N2O2S/c1-19(17,18)15-9-4-5-10-16-11-8-13-6-2-3-7-14(13)12-16/h2-3,6-7,15H,8-12H2,1H3
InChI key:InChIKey=GRYHGBSZTSZMTO-UHFFFAOYSA-N
SMILES:C(C#CCNS(C)(=O)=O)N1CC=2C(CC1)=CC=CC2
Synonyms:- Methanesulfonamide, N-[4-(3,4-dihydro-2(1H)-isoquinolinyl)-2-butyn-1-yl]-
- N-[4-(3,4-Dihydro-2(1H)-isoquinolinyl)-2-butyn-1-yl]methanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.