CymitQuimica logo

CAS 1351654-32-4

:

2-Thiophenecarboxamide, N-(4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)-, hydrochloride (1:1)

Description:
2-Thiophenecarboxamide, N-(4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structural features, which include a thiophene ring and a thiazolo-pyridine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and solubility in polar solvents due to the presence of the hydrochloride salt form. The thiazolo-pyridine structure may contribute to its pharmacological properties, making it of interest in medicinal chemistry for potential therapeutic applications. The hydrochloride form enhances its stability and solubility, which is advantageous for formulation in pharmaceutical contexts. Additionally, compounds of this nature may exhibit diverse interactions with biological targets, making them candidates for further research in drug development. As with many heterocyclic compounds, the specific reactivity and interactions can vary based on the functional groups present and the overall molecular conformation.
Formula:C11H11N3OS2·ClH
InChI:InChI=1S/C11H11N3OS2.ClH/c15-10(8-2-1-5-16-8)14-11-13-7-3-4-12-6-9(7)17-11;/h1-2,5,12H,3-4,6H2,(H,13,14,15);1H
InChI key:InChIKey=BQCJOOYTQSVKSO-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CS1)C2=NC3=C(S2)CNCC3.Cl
Synonyms:
  • 2-Thiophenecarboxamide, N-(4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.