CAS 1351668-26-2

(4-Bromo-2,6-difluorophenyl)-1-pyrrolidinylmethanone

Description:

(4-Bromo-2,6-difluorophenyl)-1-pyrrolidinylmethanone is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and a phenyl group substituted with bromine and fluorine atoms. The presence of the bromine and fluorine substituents contributes to its unique electronic properties and potential reactivity, making it of interest in medicinal chemistry and drug development. This compound may exhibit specific biological activities due to its structural features, which can influence its interaction with biological targets. Its molecular weight, solubility, and stability are influenced by the functional groups present, and it may be subject to various chemical reactions typical of ketones and aromatic compounds. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, (4-Bromo-2,6-difluorophenyl)-1-pyrrolidinylmethanone represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₁H₁₀BrF₂NO

InChI: InChI=1S/C11H10BrF2NO/c12-7-5-8(13)10(9(14)6-7)11(16)15-3-1-2-4-15/h5-6H,1-4H2

InChI key: InChIKey=CNFYYZUWVAUKKI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(Br)C=C1F)N2CCCC2

Synonyms:

• Methanone, (4-bromo-2,6-difluorophenyl)-1-pyrrolidinyl-
• (4-Bromo-2,6-difluorophenyl)-1-pyrrolidinylmethanone