CAS 13518-80-4
:2-(Trimethylsilyl)-2H-1,2,3-triazole
Description:
2-(Trimethylsilyl)-2H-1,2,3-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a trimethylsilyl group, which enhances its stability and solubility in organic solvents. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the trimethylsilyl group imparts unique properties, such as increased hydrophobicity and potential applications in organic synthesis and as a protecting group in various chemical reactions. 2-(Trimethylsilyl)-2H-1,2,3-triazole is often utilized in the field of medicinal chemistry and materials science, particularly in the development of pharmaceuticals and functional materials. Its reactivity can be attributed to the nitrogen atoms in the triazole ring, which can participate in various chemical transformations. Overall, this compound is valued for its versatility and functionalization potential in synthetic chemistry.
Formula:C5H11N3Si
InChI:InChI=1S/C5H11N3Si/c1-9(2,3)8-6-4-5-7-8/h4-5H,1-3H3
InChI key:InChIKey=DSPOVSQQYMUIGB-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)N1N=CC=N1
Synonyms:- 2-(Trimethylsilyl)-1H-1,2,3-Triazole
- 2-(trimethylsilyl)-2H-1,2,3-triazole
- 2H-1,2,3-Triazole, 2-(trimethylsilyl)-
- Aurora Ka-4379
- N-Trimethylsilyl-1,2,3-Triazole
- 2-(Trimethylsilyl)-1,2,3-triazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
