CAS 13520-94-0
:3,5-Dihydro-6-hydroxy-5-oxo-2H-indole-2-carboxylic acid
Description:
3,5-Dihydro-6-hydroxy-5-oxo-2H-indole-2-carboxylic acid, with the CAS number 13520-94-0, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features multiple functional groups, including a carboxylic acid, a hydroxyl group, and a ketone, which contribute to its reactivity and potential biological activity. The presence of the hydroxyl group suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The compound's structure indicates potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Additionally, its unique arrangement of substituents may confer specific properties, such as antioxidant or anti-inflammatory activities. Overall, 3,5-Dihydro-6-hydroxy-5-oxo-2H-indole-2-carboxylic acid is of interest in both synthetic and medicinal chemistry due to its complex structure and potential therapeutic applications.
Formula:C9H7NO4
InChI:InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h2-3,6,12H,1H2,(H,13,14)
InChI key:InChIKey=RUVIPSCOYXGWSU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC=2C(=N1)C=C(O)C(=O)C2
Synonyms:- 2H-Indole-2-carboxylic acid, 3,5-dihydro-6-hydroxy-5-oxo-
- 3,5-Dihydro-6-hydroxy-5-oxo-2H-indole-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
