CAS 135207-10-2

Thiazole, 4-(chloromethyl)-2-cyclopropyl-, hydrochloride (1:1)

Description:

Thiazole, 4-(chloromethyl)-2-cyclopropyl-, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of a chloromethyl group at the 4-position and a cyclopropyl group at the 2-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing its pharmacological profile. Safety and handling precautions are essential due to the presence of the chloromethyl group, which can be reactive and may pose health risks. Overall, this compound represents a specific class of thiazole derivatives with potential applications in drug development and research.

Formula: C₇H₈ClNS·ClH

InChI: InChI=1S/C7H8ClNS.ClH/c8-3-6-4-10-7(9-6)5-1-2-5;/h4-5H,1-3H2;1H

InChI key: InChIKey=UZEVDSKPUNNZJM-UHFFFAOYSA-N

SMILES: C(Cl)C=1N=C(SC1)C2CC2.Cl

Synonyms:

• Thiazole, 4-(chloromethyl)-2-cyclopropyl-, hydrochloride
• Thiazole, 4-(chloromethyl)-2-cyclopropyl-, hydrochloride (1:1)

4-(chloromethyl)-2-cyclopropylthiazole hydrochloride

CAS: 135207-10-2

Formula: C₇H₉Cl₂NS

Purity: 95.0%

Molecular weight: 210.12

Ref: 10-F512152