CAS 135207-17-9
:1-Cyclopropyl-1H-imidazole
Description:
1-Cyclopropyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered ring containing two nitrogen atoms at non-adjacent positions. The presence of a cyclopropyl group, a three-membered carbon ring, at the 1-position of the imidazole contributes to its unique structural and chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate solubility in polar solvents, which is common for imidazole derivatives. 1-Cyclopropyl-1H-imidazole is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and antifungal properties. Its reactivity can be influenced by the electron-donating or withdrawing effects of the cyclopropyl group, making it a valuable scaffold for drug design. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as temperature and pH, which are important considerations in its applications.
Formula:C6H8N2
InChI:InChI=1S/C6H8N2/c1-2-6(1)8-4-3-7-5-8/h3-6H,1-2H2
SMILES:C1CC1n1ccnc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-IMIDAZOLE, 1-CYCLOPROPYL-
CAS:Formula:C6H8N2Purity:95%Color and Shape:SolidMolecular weight:108.14111-Cyclopropyl-1H-imidazole
CAS:1-Cyclopropyl-1H-imidazoleFormula:C6H8N2Purity:95%Color and Shape: clear. colourless viscous liquidMolecular weight:108.14g/mol1-Cyclopropyl-1H-imidazole
CAS:Formula:C6H8N2Purity:≥95%Color and Shape:LiquidMolecular weight:108.1441-Cyclopropyl-1H-imidazole
CAS:1-Cyclopropyl-1H-imidazole is an antifungal agent that has been shown to be active against candida. It acts by inhibiting the synthesis of ergosterol, which is essential for fungal cell membranes. Its activity against Candida albicans was shown in a gas phase study and also in a conformational analysis. 1-Cyclopropyl-1H-imidazole has been found to be active against other fungi including Trichophyton mentagrophytes and Aspergillus niger. This triazole derivative inhibits the growth of bacteria by binding to the cytochrome P450 system and preventing the production of ergosterol, which is essential for fungal cell membranes.Formula:C6H8N2Purity:Min. 95%Molecular weight:108.14 g/mol



